C14H23NO3S — CID 65015475
3,3-dimethyl-2-[(4-methylphenoxy)methyl]butane-1-sulfonamide (PubChem CID 65015475) has the molecular formula C14H23NO3S and a molecular weight of 285.41 g/mol. Its IUPAC name is 3,3-dimethyl-2-[(4-methylphenoxy)methyl]butane-1-sulfonamide.
| Compound Name | 3,3-dimethyl-2-[(4-methylphenoxy)methyl]butane-1-sulfonamide |
|---|---|
| PubChem CID | 65015475 |
| Molecular Formula | C14H23NO3S |
| Molecular Weight | 285.41 g/mol |
| Exact Mass | 285.14 |
| IUPAC Name | 3,3-dimethyl-2-[(4-methylphenoxy)methyl]butane-1-sulfonamide |
| SMILES | Cc1ccc(OCC(CS(N)(=O)=O)C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H23NO3S/c1-11-5-7-13(8-6-11)18-9-12(14(2,3)4)10-19(15,16)17/h5-8,12H,9-10H2,1-4H3,(H2,15,16,17) |
| InChIKey | BEFCNOZUVPIYNA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.41 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |