C15H24O — CID 90455432
1-methyl-4-[(2S)-2,4,4-trimethylpentoxy]benzene (PubChem CID 90455432) has the molecular formula C15H24O and a molecular weight of 220.36 g/mol. Its IUPAC name is 1-methyl-4-[(2S)-2,4,4-trimethylpentoxy]benzene.
| Compound Name | 1-methyl-4-[(2S)-2,4,4-trimethylpentoxy]benzene |
|---|---|
| PubChem CID | 90455432 |
| Molecular Formula | C15H24O |
| Molecular Weight | 220.36 g/mol |
| Exact Mass | 220.18 |
| IUPAC Name | 1-methyl-4-[(2S)-2,4,4-trimethylpentoxy]benzene |
| SMILES | Cc1ccc(OC[C@@H](C)CC(C)(C)C)cc1 |
| InChI | InChI=1S/C15H24O/c1-12-6-8-14(9-7-12)16-11-13(2)10-15(3,4)5/h6-9,13H,10-11H2,1-5H3/t13-/m0/s1 |
| InChIKey | GALVVCRKPZUXJV-ZDUSSCGKSA-N |
| XLogP | 4.45 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.36 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |