C14H24NO2+ — CID 8741445
tert-butyl-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium (PubChem CID 8741445) has the molecular formula C14H24NO2+ and a molecular weight of 238.35 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium.
| Compound Name | tert-butyl-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium |
|---|---|
| PubChem CID | 8741445 |
| Molecular Formula | C14H24NO2+ |
| Molecular Weight | 238.35 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | tert-butyl-[(2R)-2-hydroxy-3-(4-methylphenoxy)propyl]azanium |
| SMILES | Cc1ccc(OC[C@H](O)C[NH2+]C(C)(C)C)cc1 |
| InChI | InChI=1S/C14H23NO2/c1-11-5-7-13(8-6-11)17-10-12(16)9-15-14(2,3)4/h5-8,12,15-16H,9-10H2,1-4H3/p+1/t12-/m1/s1 |
| InChIKey | LWOHFRGZWYFRBJ-GFCCVEGCSA-O |
| XLogP | 1.10 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.35 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |