C15H26NO2+ — CID 25271750
tert-butyl-[(2R)-3-(2,3-dimethylphenoxy)-2-hydroxypropyl]azanium (PubChem CID 25271750) has the molecular formula C15H26NO2+ and a molecular weight of 252.38 g/mol. Its IUPAC name is tert-butyl-[(2R)-3-(2,3-dimethylphenoxy)-2-hydroxypropyl]azanium.
| Compound Name | tert-butyl-[(2R)-3-(2,3-dimethylphenoxy)-2-hydroxypropyl]azanium |
|---|---|
| PubChem CID | 25271750 |
| Molecular Formula | C15H26NO2+ |
| Molecular Weight | 252.38 g/mol |
| Exact Mass | 252.20 |
| IUPAC Name | tert-butyl-[(2R)-3-(2,3-dimethylphenoxy)-2-hydroxypropyl]azanium |
| SMILES | Cc1cccc(OC[C@H](O)C[NH2+]C(C)(C)C)c1C |
| InChI | InChI=1S/C15H25NO2/c1-11-7-6-8-14(12(11)2)18-10-13(17)9-16-15(3,4)5/h6-8,13,16-17H,9-10H2,1-5H3/p+1/t13-/m1/s1 |
| InChIKey | RKUQLAPSGZJLGP-CYBMUJFWSA-O |
| XLogP | 1.41 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |