C17H30ClNO2 — CID 2830249
tert-butyl-[2-hydroxy-3-(5-methyl-2-propan-2-ylphenoxy)propyl]azanium chloride (PubChem CID 2830249) has the molecular formula C17H30ClNO2 and a molecular weight of 315.89 g/mol. Its IUPAC name is tert-butyl-[2-hydroxy-3-(5-methyl-2-propan-2-ylphenoxy)propyl]azanium chloride.
| Compound Name | tert-butyl-[2-hydroxy-3-(5-methyl-2-propan-2-ylphenoxy)propyl]azanium chloride |
|---|---|
| PubChem CID | 2830249 |
| Molecular Formula | C17H30ClNO2 |
| Molecular Weight | 315.89 g/mol |
| Exact Mass | 315.20 |
| IUPAC Name | tert-butyl-[2-hydroxy-3-(5-methyl-2-propan-2-ylphenoxy)propyl]azanium chloride |
| SMILES | Cc1ccc(C(C)C)c(OCC(O)C[NH2+]C(C)(C)C)c1.[Cl-] |
| InChI | InChI=1S/C17H29NO2.ClH/c1-12(2)15-8-7-13(3)9-16(15)20-11-14(19)10-18-17(4,5)6;/h7-9,12,14,18-19H,10-11H2,1-6H3;1H |
| InChIKey | MKYOFZHLZIUIBX-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 46.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.89 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |