C15H23BrO — CID 65014456
1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2,3-dimethylbenzene (PubChem CID 65014456) has the molecular formula C15H23BrO and a molecular weight of 299.25 g/mol. Its IUPAC name is 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2,3-dimethylbenzene.
| Compound Name | 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 65014456 |
| Molecular Formula | C15H23BrO |
| Molecular Weight | 299.25 g/mol |
| Exact Mass | 298.09 |
| IUPAC Name | 1-[2-(bromomethyl)-3,3-dimethylbutoxy]-2,3-dimethylbenzene |
| SMILES | Cc1cccc(OCC(CBr)C(C)(C)C)c1C |
| InChI | InChI=1S/C15H23BrO/c1-11-7-6-8-14(12(11)2)17-10-13(9-16)15(3,4)5/h6-8,13H,9-10H2,1-5H3 |
| InChIKey | XZTJMBBLYTXXCV-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.25 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|