C12H18O3 — CID 4198790
1-(2,2-dimethoxyethoxy)-2,3-dimethylbenzene (PubChem CID 4198790) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethoxy)-2,3-dimethylbenzene.
| Compound Name | 1-(2,2-dimethoxyethoxy)-2,3-dimethylbenzene |
|---|---|
| PubChem CID | 4198790 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(2,2-dimethoxyethoxy)-2,3-dimethylbenzene |
| SMILES | COC(COc1cccc(C)c1C)OC |
| InChI | InChI=1S/C12H18O3/c1-9-6-5-7-11(10(9)2)15-8-12(13-3)14-4/h5-7,12H,8H2,1-4H3 |
| InChIKey | ZTLLPDNIUXEYEF-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|