C12H18O3 — CID 66223177
1-(2,2-dimethoxyethoxy)-2-ethylbenzene (PubChem CID 66223177) has the molecular formula C12H18O3 and a molecular weight of 210.27 g/mol. Its IUPAC name is 1-(2,2-dimethoxyethoxy)-2-ethylbenzene.
| Compound Name | 1-(2,2-dimethoxyethoxy)-2-ethylbenzene |
|---|---|
| PubChem CID | 66223177 |
| Molecular Formula | C12H18O3 |
| Molecular Weight | 210.27 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | 1-(2,2-dimethoxyethoxy)-2-ethylbenzene |
| SMILES | CCc1ccccc1OCC(OC)OC |
| InChI | InChI=1S/C12H18O3/c1-4-10-7-5-6-8-11(10)15-9-12(13-2)14-3/h5-8,12H,4,9H2,1-3H3 |
| InChIKey | YCSUBNQDFCPRJZ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.27 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|