C12H15NO — CID 43367428
3-(2,3-dimethylphenoxy)-2-methylpropanenitrile (PubChem CID 43367428) has the molecular formula C12H15NO and a molecular weight of 189.26 g/mol. Its IUPAC name is 3-(2,3-dimethylphenoxy)-2-methylpropanenitrile.
| Compound Name | 3-(2,3-dimethylphenoxy)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 43367428 |
| Molecular Formula | C12H15NO |
| Molecular Weight | 189.26 g/mol |
| Exact Mass | 189.12 |
| IUPAC Name | 3-(2,3-dimethylphenoxy)-2-methylpropanenitrile |
| SMILES | Cc1cccc(OCC(C)C#N)c1C |
| InChI | InChI=1S/C12H15NO/c1-9(7-13)8-14-12-6-4-5-10(2)11(12)3/h4-6,9H,8H2,1-3H3 |
| InChIKey | MEBQNCMSDSSPKP-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.26 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |