C15H22N2O — CID 63027852
4-(2,3-dimethylphenoxy)-2-(propan-2-ylamino)butanenitrile (PubChem CID 63027852) has the molecular formula C15H22N2O and a molecular weight of 246.35 g/mol. Its IUPAC name is 4-(2,3-dimethylphenoxy)-2-(propan-2-ylamino)butanenitrile.
| Compound Name | 4-(2,3-dimethylphenoxy)-2-(propan-2-ylamino)butanenitrile |
|---|---|
| PubChem CID | 63027852 |
| Molecular Formula | C15H22N2O |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.17 |
| IUPAC Name | 4-(2,3-dimethylphenoxy)-2-(propan-2-ylamino)butanenitrile |
| SMILES | Cc1cccc(OCCC(C#N)NC(C)C)c1C |
| InChI | InChI=1S/C15H22N2O/c1-11(2)17-14(10-16)8-9-18-15-7-5-6-12(3)13(15)4/h5-7,11,14,17H,8-9H2,1-4H3 |
| InChIKey | JOGWMBQZTXHDMA-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 45.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |