C20H20N2O — CID 82137772
4-[1-cyano-4-(2,3-dimethylphenoxy)butyl]benzonitrile (PubChem CID 82137772) has the molecular formula C20H20N2O and a molecular weight of 304.39 g/mol. Its IUPAC name is 4-[1-cyano-4-(2,3-dimethylphenoxy)butyl]benzonitrile.
| Compound Name | 4-[1-cyano-4-(2,3-dimethylphenoxy)butyl]benzonitrile |
|---|---|
| PubChem CID | 82137772 |
| Molecular Formula | C20H20N2O |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 4-[1-cyano-4-(2,3-dimethylphenoxy)butyl]benzonitrile |
| SMILES | Cc1cccc(OCCCC(C#N)c2ccc(C#N)cc2)c1C |
| InChI | InChI=1S/C20H20N2O/c1-15-5-3-7-20(16(15)2)23-12-4-6-19(14-22)18-10-8-17(13-21)9-11-18/h3,5,7-11,19H,4,6,12H2,1-2H3 |
| InChIKey | NRHMBAQAYWIDJC-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 56.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|