C19H20FNO — CID 82137122
5-(2-ethylphenoxy)-2-(4-fluorophenyl)pentanenitrile (PubChem CID 82137122) has the molecular formula C19H20FNO and a molecular weight of 297.37 g/mol. Its IUPAC name is 5-(2-ethylphenoxy)-2-(4-fluorophenyl)pentanenitrile.
| Compound Name | 5-(2-ethylphenoxy)-2-(4-fluorophenyl)pentanenitrile |
|---|---|
| PubChem CID | 82137122 |
| Molecular Formula | C19H20FNO |
| Molecular Weight | 297.37 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | 5-(2-ethylphenoxy)-2-(4-fluorophenyl)pentanenitrile |
| SMILES | CCc1ccccc1OCCCC(C#N)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H20FNO/c1-2-15-6-3-4-8-19(15)22-13-5-7-17(14-21)16-9-11-18(20)12-10-16/h3-4,6,8-12,17H,2,5,7,13H2,1H3 |
| InChIKey | HVXCLJVUMVEWMC-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.37 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|