C19H21NO3 — CID 20986781
4-[2-(2,3-dimethylphenoxy)ethoxy]-3-ethoxybenzonitrile (PubChem CID 20986781) has the molecular formula C19H21NO3 and a molecular weight of 311.38 g/mol. Its IUPAC name is 4-[2-(2,3-dimethylphenoxy)ethoxy]-3-ethoxybenzonitrile.
| Compound Name | 4-[2-(2,3-dimethylphenoxy)ethoxy]-3-ethoxybenzonitrile |
|---|---|
| PubChem CID | 20986781 |
| Molecular Formula | C19H21NO3 |
| Molecular Weight | 311.38 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 4-[2-(2,3-dimethylphenoxy)ethoxy]-3-ethoxybenzonitrile |
| SMILES | CCOc1cc(C#N)ccc1OCCOc1cccc(C)c1C |
| InChI | InChI=1S/C19H21NO3/c1-4-21-19-12-16(13-20)8-9-18(19)23-11-10-22-17-7-5-6-14(2)15(17)3/h5-9,12H,4,10-11H2,1-3H3 |
| InChIKey | SGPBEQGTCFIFFI-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 51.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|