C10H9Br2NO — CID 43367465
3-(2,6-dibromophenoxy)-2-methylpropanenitrile (PubChem CID 43367465) has the molecular formula C10H9Br2NO and a molecular weight of 319.00 g/mol. Its IUPAC name is 3-(2,6-dibromophenoxy)-2-methylpropanenitrile.
| Compound Name | 3-(2,6-dibromophenoxy)-2-methylpropanenitrile |
|---|---|
| PubChem CID | 43367465 |
| Molecular Formula | C10H9Br2NO |
| Molecular Weight | 319.00 g/mol |
| Exact Mass | 316.91 |
| IUPAC Name | 3-(2,6-dibromophenoxy)-2-methylpropanenitrile |
| SMILES | CC(C#N)COc1c(Br)cccc1Br |
| InChI | InChI=1S/C10H9Br2NO/c1-7(5-13)6-14-10-8(11)3-2-4-9(10)12/h2-4,7H,6H2,1H3 |
| InChIKey | VDTDNLVUDJJOIR-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |