C16H13Br2NO2 — CID 43289580
4-[3-(2,6-dibromophenoxy)propoxy]benzonitrile (PubChem CID 43289580) has the molecular formula C16H13Br2NO2 and a molecular weight of 411.09 g/mol. Its IUPAC name is 4-[3-(2,6-dibromophenoxy)propoxy]benzonitrile.
| Compound Name | 4-[3-(2,6-dibromophenoxy)propoxy]benzonitrile |
|---|---|
| PubChem CID | 43289580 |
| Molecular Formula | C16H13Br2NO2 |
| Molecular Weight | 411.09 g/mol |
| Exact Mass | 408.93 |
| IUPAC Name | 4-[3-(2,6-dibromophenoxy)propoxy]benzonitrile |
| SMILES | N#Cc1ccc(OCCCOc2c(Br)cccc2Br)cc1 |
| InChI | InChI=1S/C16H13Br2NO2/c17-14-3-1-4-15(18)16(14)21-10-2-9-20-13-7-5-12(11-19)6-8-13/h1,3-8H,2,9-10H2 |
| InChIKey | DVRJKXBUMRLRSC-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.09 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|