C16H23NO2 — CID 66233382
4-[3-(3,3-dimethylbutoxy)propoxy]benzonitrile (PubChem CID 66233382) has the molecular formula C16H23NO2 and a molecular weight of 261.36 g/mol. Its IUPAC name is 4-[3-(3,3-dimethylbutoxy)propoxy]benzonitrile.
| Compound Name | 4-[3-(3,3-dimethylbutoxy)propoxy]benzonitrile |
|---|---|
| PubChem CID | 66233382 |
| Molecular Formula | C16H23NO2 |
| Molecular Weight | 261.36 g/mol |
| Exact Mass | 261.17 |
| IUPAC Name | 4-[3-(3,3-dimethylbutoxy)propoxy]benzonitrile |
| SMILES | CC(C)(C)CCOCCCOc1ccc(C#N)cc1 |
| InChI | InChI=1S/C16H23NO2/c1-16(2,3)9-12-18-10-4-11-19-15-7-5-14(13-17)6-8-15/h5-8H,4,9-12H2,1-3H3 |
| InChIKey | ZIWKMTWZIVIYQV-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.36 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|