C14H24ClNO2 — CID 164625864
(2R)-1-(2,3-dimethylphenoxy)-N-(2-methoxyethyl)propan-2-amine;hydrochloride (PubChem CID 164625864) has the molecular formula C14H24ClNO2 and a molecular weight of 273.80 g/mol. Its IUPAC name is (2R)-1-(2,3-dimethylphenoxy)-N-(2-methoxyethyl)propan-2-amine;hydrochloride.
| Compound Name | (2R)-1-(2,3-dimethylphenoxy)-N-(2-methoxyethyl)propan-2-amine;hydrochloride |
|---|---|
| PubChem CID | 164625864 |
| Molecular Formula | C14H24ClNO2 |
| Molecular Weight | 273.80 g/mol |
| Exact Mass | 273.15 |
| IUPAC Name | (2R)-1-(2,3-dimethylphenoxy)-N-(2-methoxyethyl)propan-2-amine;hydrochloride |
| SMILES | COCCN[C@H](C)COc1cccc(C)c1C.Cl |
| InChI | InChI=1S/C14H23NO2.ClH/c1-11-6-5-7-14(13(11)3)17-10-12(2)15-8-9-16-4;/h5-7,12,15H,8-10H2,1-4H3;1H/t12-;/m1./s1 |
| InChIKey | VAABGQMDBRRPLZ-UTONKHPSSA-N |
| XLogP | 2.73 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.80 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|