C17H24NO4+ — CID 86294885
tert-butyl-[(2R)-2-hydroxy-3-(5-methyl-2-oxochromen-8-yl)oxypropyl]azanium (PubChem CID 86294885) has the molecular formula C17H24NO4+ and a molecular weight of 306.38 g/mol. Its IUPAC name is tert-butyl-[(2R)-2-hydroxy-3-(5-methyl-2-oxochromen-8-yl)oxypropyl]azanium.
| Compound Name | tert-butyl-[(2R)-2-hydroxy-3-(5-methyl-2-oxochromen-8-yl)oxypropyl]azanium |
|---|---|
| PubChem CID | 86294885 |
| Molecular Formula | C17H24NO4+ |
| Molecular Weight | 306.38 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | tert-butyl-[(2R)-2-hydroxy-3-(5-methyl-2-oxochromen-8-yl)oxypropyl]azanium |
| SMILES | Cc1ccc(OC[C@H](O)C[NH2+]C(C)(C)C)c2oc(=O)ccc12 |
| InChI | InChI=1S/C17H23NO4/c1-11-5-7-14(16-13(11)6-8-15(20)22-16)21-10-12(19)9-18-17(2,3)4/h5-8,12,18-19H,9-10H2,1-4H3/p+1/t12-/m1/s1 |
| InChIKey | CIJVBYRUFLGDHY-GFCCVEGCSA-O |
| XLogP | 1.20 |
| TPSA | 76.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.38 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|