C17H25N2O3+ — CID 24849130
tert-butyl-[2-hydroxy-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropyl]azanium (PubChem CID 24849130) has the molecular formula C17H25N2O3+ and a molecular weight of 305.40 g/mol. Its IUPAC name is tert-butyl-[2-hydroxy-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropyl]azanium.
| Compound Name | tert-butyl-[2-hydroxy-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropyl]azanium |
|---|---|
| PubChem CID | 24849130 |
| Molecular Formula | C17H25N2O3+ |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | tert-butyl-[2-hydroxy-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropyl]azanium |
| SMILES | Cn1cc(OCC(O)C[NH2+]C(C)(C)C)c2ccccc2c1=O |
| InChI | InChI=1S/C17H24N2O3/c1-17(2,3)18-9-12(20)11-22-15-10-19(4)16(21)14-8-6-5-7-13(14)15/h5-8,10,12,18,20H,9,11H2,1-4H3/p+1 |
| InChIKey | TWVUMMQUXMYOOH-UHFFFAOYSA-O |
| XLogP | 0.64 |
| TPSA | 68.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |