C22H32N2O4 — CID 23276985
[1-(tert-butylamino)-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropan-2-yl] pentanoate (PubChem CID 23276985) has the molecular formula C22H32N2O4 and a molecular weight of 388.51 g/mol. Its IUPAC name is [1-(tert-butylamino)-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropan-2-yl] pentanoate.
| Compound Name | [1-(tert-butylamino)-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropan-2-yl] pentanoate |
|---|---|
| PubChem CID | 23276985 |
| Molecular Formula | C22H32N2O4 |
| Molecular Weight | 388.51 g/mol |
| Exact Mass | 388.24 |
| IUPAC Name | [1-(tert-butylamino)-3-(2-methyl-1-oxoisoquinolin-4-yl)oxypropan-2-yl] pentanoate |
| SMILES | CCCCC(=O)OC(CNC(C)(C)C)COc1cn(C)c(=O)c2ccccc12 |
| InChI | InChI=1S/C22H32N2O4/c1-6-7-12-20(25)28-16(13-23-22(2,3)4)15-27-19-14-24(5)21(26)18-11-9-8-10-17(18)19/h8-11,14,16,23H,6-7,12-13,15H2,1-5H3 |
| InChIKey | JVEBBZKLLISZQU-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |