C16H27N2O4+ — CID 86308572
tert-butyl-[(2S)-2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]azanium (PubChem CID 86308572) has the molecular formula C16H27N2O4+ and a molecular weight of 311.40 g/mol. Its IUPAC name is tert-butyl-[(2S)-2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]azanium.
| Compound Name | tert-butyl-[(2S)-2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]azanium |
|---|---|
| PubChem CID | 86308572 |
| Molecular Formula | C16H27N2O4+ |
| Molecular Weight | 311.40 g/mol |
| Exact Mass | 311.20 |
| IUPAC Name | tert-butyl-[(2S)-2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]azanium |
| SMILES | CNC(=O)COc1ccccc1OC[C@@H](O)C[NH2+]C(C)(C)C |
| InChI | InChI=1S/C16H26N2O4/c1-16(2,3)18-9-12(19)10-21-13-7-5-6-8-14(13)22-11-15(20)17-4/h5-8,12,18-19H,9-11H2,1-4H3,(H,17,20)/p+1/t12-/m0/s1 |
| InChIKey | UWCBNAVPISMFJZ-LBPRGKRZSA-O |
| XLogP | -0.09 |
| TPSA | 84.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.40 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |