C21H34N4O8 — CID 70399217
[5-[[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate (PubChem CID 70399217) has the molecular formula C21H34N4O8 and a molecular weight of 470.52 g/mol. Its IUPAC name is [5-[[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate.
| Compound Name | [5-[[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate |
|---|---|
| PubChem CID | 70399217 |
| Molecular Formula | C21H34N4O8 |
| Molecular Weight | 470.52 g/mol |
| Exact Mass | 470.24 |
| IUPAC Name | [5-[[2-[[2-hydroxy-3-[2-[2-(methylamino)-2-oxoethoxy]phenoxy]propyl]amino]-2-methylpropyl]amino]-5-oxopentyl] nitrate |
| SMILES | CNC(=O)COc1ccccc1OCC(O)CNC(C)(C)CNC(=O)CCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C21H34N4O8/c1-21(2,15-23-19(27)10-6-7-11-33-25(29)30)24-12-16(26)13-31-17-8-4-5-9-18(17)32-14-20(28)22-3/h4-5,8-9,16,24,26H,6-7,10-15H2,1-3H3,(H,22,28)(H,23,27) |
| InChIKey | QYGAIDDYJSIWPK-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 161.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.52 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|