C10H21N3O4 — CID 14799036
[5-[(3-amino-2,2-dimethylpropyl)amino]-5-oxopentyl] nitrate (PubChem CID 14799036) has the molecular formula C10H21N3O4 and a molecular weight of 247.29 g/mol. Its IUPAC name is [5-[(3-amino-2,2-dimethylpropyl)amino]-5-oxopentyl] nitrate.
| Compound Name | [5-[(3-amino-2,2-dimethylpropyl)amino]-5-oxopentyl] nitrate |
|---|---|
| PubChem CID | 14799036 |
| Molecular Formula | C10H21N3O4 |
| Molecular Weight | 247.29 g/mol |
| Exact Mass | 247.15 |
| IUPAC Name | [5-[(3-amino-2,2-dimethylpropyl)amino]-5-oxopentyl] nitrate |
| SMILES | CC(C)(CN)CNC(=O)CCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C10H21N3O4/c1-10(2,7-11)8-12-9(14)5-3-4-6-17-13(15)16/h3-8,11H2,1-2H3,(H,12,14) |
| InChIKey | JNXMPWNMKUOLIP-UHFFFAOYSA-N |
| XLogP | 0.47 |
| TPSA | 107.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.29 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|