C20H38N4O6 — CID 57210877
bis[4-[(3-amino-2,2-dimethylpropyl)amino]-4-oxobutyl] oxalate (PubChem CID 57210877) has the molecular formula C20H38N4O6 and a molecular weight of 430.55 g/mol. Its IUPAC name is bis[4-[(3-amino-2,2-dimethylpropyl)amino]-4-oxobutyl] oxalate.
| Compound Name | bis[4-[(3-amino-2,2-dimethylpropyl)amino]-4-oxobutyl] oxalate |
|---|---|
| PubChem CID | 57210877 |
| Molecular Formula | C20H38N4O6 |
| Molecular Weight | 430.55 g/mol |
| Exact Mass | 430.28 |
| IUPAC Name | bis[4-[(3-amino-2,2-dimethylpropyl)amino]-4-oxobutyl] oxalate |
| SMILES | CC(C)(CN)CNC(=O)CCCOC(=O)C(=O)OCCCC(=O)NCC(C)(C)CN |
| InChI | InChI=1S/C20H38N4O6/c1-19(2,11-21)13-23-15(25)7-5-9-29-17(27)18(28)30-10-6-8-16(26)24-14-20(3,4)12-22/h5-14,21-22H2,1-4H3,(H,23,25)(H,24,26) |
| InChIKey | GLTRFBDGXYSGQW-UHFFFAOYSA-N |
| XLogP | -0.16 |
| TPSA | 162.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.55 |
| LogP ≤ 5 | -0.16 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|