C22H42N4O6 — CID 57320771
bis[4-[2-(diethylamino)ethylamino]-4-oxobutyl] oxalate (PubChem CID 57320771) has the molecular formula C22H42N4O6 and a molecular weight of 458.60 g/mol. Its IUPAC name is bis[4-[2-(diethylamino)ethylamino]-4-oxobutyl] oxalate.
| Compound Name | bis[4-[2-(diethylamino)ethylamino]-4-oxobutyl] oxalate |
|---|---|
| PubChem CID | 57320771 |
| Molecular Formula | C22H42N4O6 |
| Molecular Weight | 458.60 g/mol |
| Exact Mass | 458.31 |
| IUPAC Name | bis[4-[2-(diethylamino)ethylamino]-4-oxobutyl] oxalate |
| SMILES | CCN(CC)CCNC(=O)CCCOC(=O)C(=O)OCCCC(=O)NCCN(CC)CC |
| InChI | InChI=1S/C22H42N4O6/c1-5-25(6-2)15-13-23-19(27)11-9-17-31-21(29)22(30)32-18-10-12-20(28)24-14-16-26(7-3)8-4/h5-18H2,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | QBDSMVIDFBENQY-UHFFFAOYSA-N |
| XLogP | 0.55 |
| TPSA | 117.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.60 |
| LogP ≤ 5 | 0.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|