C9H20N4O2 — CID 127518867
2-(carbamoylamino)-N-[2-(diethylamino)ethyl]acetamide (PubChem CID 127518867) has the molecular formula C9H20N4O2 and a molecular weight of 216.28 g/mol. Its IUPAC name is 2-(carbamoylamino)-N-[2-(diethylamino)ethyl]acetamide.
| Compound Name | 2-(carbamoylamino)-N-[2-(diethylamino)ethyl]acetamide |
|---|---|
| PubChem CID | 127518867 |
| Molecular Formula | C9H20N4O2 |
| Molecular Weight | 216.28 g/mol |
| Exact Mass | 216.16 |
| IUPAC Name | 2-(carbamoylamino)-N-[2-(diethylamino)ethyl]acetamide |
| SMILES | CCN(CC)CCNC(=O)CNC(N)=O |
| InChI | InChI=1S/C9H20N4O2/c1-3-13(4-2)6-5-11-8(14)7-12-9(10)15/h3-7H2,1-2H3,(H,11,14)(H3,10,12,15) |
| InChIKey | RPPAJLDYSLBBFY-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.28 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |