C16H25ClN2OS — CID 112759806
4-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]butanamide (PubChem CID 112759806) has the molecular formula C16H25ClN2OS and a molecular weight of 328.91 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]butanamide |
|---|---|
| PubChem CID | 112759806 |
| Molecular Formula | C16H25ClN2OS |
| Molecular Weight | 328.91 g/mol |
| Exact Mass | 328.14 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]butanamide |
| SMILES | CCN(CC)CCNC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H25ClN2OS/c1-3-19(4-2)12-11-18-16(20)6-5-13-21-15-9-7-14(17)8-10-15/h7-10H,3-6,11-13H2,1-2H3,(H,18,20) |
| InChIKey | LNSHDIOJKNLHOK-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.91 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|