C16H24ClNO2S — CID 96542840
4-(4-chlorophenyl)sulfanyl-N-[(2R)-2-hydroxy-3,3-dimethylbutyl]butanamide (PubChem CID 96542840) has the molecular formula C16H24ClNO2S and a molecular weight of 329.89 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[(2R)-2-hydroxy-3,3-dimethylbutyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[(2R)-2-hydroxy-3,3-dimethylbutyl]butanamide |
|---|---|
| PubChem CID | 96542840 |
| Molecular Formula | C16H24ClNO2S |
| Molecular Weight | 329.89 g/mol |
| Exact Mass | 329.12 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[(2R)-2-hydroxy-3,3-dimethylbutyl]butanamide |
| SMILES | CC(C)(C)[C@@H](O)CNC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H24ClNO2S/c1-16(2,3)14(19)11-18-15(20)5-4-10-21-13-8-6-12(17)7-9-13/h6-9,14,19H,4-5,10-11H2,1-3H3,(H,18,20)/t14-/m0/s1 |
| InChIKey | UIPWIFLKSRSKQI-AWEZNQCLSA-N |
| XLogP | 3.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.89 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|