C17H27ClN2OS — CID 112792876
4-(4-chlorophenyl)sulfanyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]butanamide (PubChem CID 112792876) has the molecular formula C17H27ClN2OS and a molecular weight of 342.94 g/mol. Its IUPAC name is 4-(4-chlorophenyl)sulfanyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]butanamide.
| Compound Name | 4-(4-chlorophenyl)sulfanyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]butanamide |
|---|---|
| PubChem CID | 112792876 |
| Molecular Formula | C17H27ClN2OS |
| Molecular Weight | 342.94 g/mol |
| Exact Mass | 342.15 |
| IUPAC Name | 4-(4-chlorophenyl)sulfanyl-N-[3-(dimethylamino)-2,2-dimethylpropyl]butanamide |
| SMILES | CN(C)CC(C)(C)CNC(=O)CCCSc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H27ClN2OS/c1-17(2,13-20(3)4)12-19-16(21)6-5-11-22-15-9-7-14(18)8-10-15/h7-10H,5-6,11-13H2,1-4H3,(H,19,21) |
| InChIKey | ATACKVGYNLACFP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.94 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|