C17H26ClN3O2S — CID 5036041
2-acetamido-3-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]propanamide (PubChem CID 5036041) has the molecular formula C17H26ClN3O2S and a molecular weight of 371.93 g/mol. Its IUPAC name is 2-acetamido-3-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]propanamide.
| Compound Name | 2-acetamido-3-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 5036041 |
| Molecular Formula | C17H26ClN3O2S |
| Molecular Weight | 371.93 g/mol |
| Exact Mass | 371.14 |
| IUPAC Name | 2-acetamido-3-(4-chlorophenyl)sulfanyl-N-[2-(diethylamino)ethyl]propanamide |
| SMILES | CCN(CC)CCNC(=O)C(CSc1ccc(Cl)cc1)NC(C)=O |
| InChI | InChI=1S/C17H26ClN3O2S/c1-4-21(5-2)11-10-19-17(23)16(20-13(3)22)12-24-15-8-6-14(18)7-9-15/h6-9,16H,4-5,10-12H2,1-3H3,(H,19,23)(H,20,22) |
| InChIKey | YSPAWKKPVYRBOS-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.93 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |