C18H27ClN2O3S — CID 3306259
2-acetamido-N-(3-butoxypropyl)-3-(4-chlorophenyl)sulfanylpropanamide (PubChem CID 3306259) has the molecular formula C18H27ClN2O3S and a molecular weight of 386.95 g/mol. Its IUPAC name is 2-acetamido-N-(3-butoxypropyl)-3-(4-chlorophenyl)sulfanylpropanamide.
| Compound Name | 2-acetamido-N-(3-butoxypropyl)-3-(4-chlorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 3306259 |
| Molecular Formula | C18H27ClN2O3S |
| Molecular Weight | 386.95 g/mol |
| Exact Mass | 386.14 |
| IUPAC Name | 2-acetamido-N-(3-butoxypropyl)-3-(4-chlorophenyl)sulfanylpropanamide |
| SMILES | CCCCOCCCNC(=O)C(CSc1ccc(Cl)cc1)NC(C)=O |
| InChI | InChI=1S/C18H27ClN2O3S/c1-3-4-11-24-12-5-10-20-18(23)17(21-14(2)22)13-25-16-8-6-15(19)7-9-16/h6-9,17H,3-5,10-13H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | GBLYUILXYRBONN-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.95 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|