C15H22FN3O2S — CID 4282411
2-acetamido-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide (PubChem CID 4282411) has the molecular formula C15H22FN3O2S and a molecular weight of 327.43 g/mol. Its IUPAC name is 2-acetamido-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide.
| Compound Name | 2-acetamido-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide |
|---|---|
| PubChem CID | 4282411 |
| Molecular Formula | C15H22FN3O2S |
| Molecular Weight | 327.43 g/mol |
| Exact Mass | 327.14 |
| IUPAC Name | 2-acetamido-N-[2-(dimethylamino)ethyl]-3-(4-fluorophenyl)sulfanylpropanamide |
| SMILES | CC(=O)NC(CSc1ccc(F)cc1)C(=O)NCCN(C)C |
| InChI | InChI=1S/C15H22FN3O2S/c1-11(20)18-14(15(21)17-8-9-19(2)3)10-22-13-6-4-12(16)5-7-13/h4-7,14H,8-10H2,1-3H3,(H,17,21)(H,18,20) |
| InChIKey | JCPPSPFTXNJATN-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.43 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |