C18H38N4O2 — CID 53387315
N-[2-[2-aminoethyl-[2-(hexanoylamino)ethyl]amino]ethyl]hexanamide (PubChem CID 53387315) has the molecular formula C18H38N4O2 and a molecular weight of 342.53 g/mol. Its IUPAC name is N-[2-[2-aminoethyl-[2-(hexanoylamino)ethyl]amino]ethyl]hexanamide.
| Compound Name | N-[2-[2-aminoethyl-[2-(hexanoylamino)ethyl]amino]ethyl]hexanamide |
|---|---|
| PubChem CID | 53387315 |
| Molecular Formula | C18H38N4O2 |
| Molecular Weight | 342.53 g/mol |
| Exact Mass | 342.30 |
| IUPAC Name | N-[2-[2-aminoethyl-[2-(hexanoylamino)ethyl]amino]ethyl]hexanamide |
| SMILES | CCCCCC(=O)NCCN(CCN)CCNC(=O)CCCCC |
| InChI | InChI=1S/C18H38N4O2/c1-3-5-7-9-17(23)20-12-15-22(14-11-19)16-13-21-18(24)10-8-6-4-2/h3-16,19H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | DXOJNLXCWHFJAR-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 87.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.53 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|