About ethane;8-nitrooxyoctanoic acid
ethane;8-nitrooxyoctanoic acid (PubChem CID 173056410) has the molecular formula C10H21NO5
and a molecular weight of 235.28 g/mol. Its IUPAC name is ethane;8-nitrooxyoctanoic acid.
Molecular Properties
| Compound Name | ethane;8-nitrooxyoctanoic acid |
| PubChem CID | 173056410 |
| Molecular Formula | C10H21NO5 |
| Molecular Weight | 235.28 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | ethane;8-nitrooxyoctanoic acid |
| SMILES | CC.O=C(O)CCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C8H15NO5.C2H6/c10-8(11)6-4-2-1-3-5-7-14-9(12)13;1-2/h1-7H2,(H,10,11);1-2H3 |
| InChIKey | QXSKTNKSJYUDPI-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.28 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;8-nitrooxyoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;8-nitrooxyoctanoic acid?
The IUPAC name of ethane;8-nitrooxyoctanoic acid (CID 173056410) is ethane;8-nitrooxyoctanoic acid.
What is the SMILES notation for ethane;8-nitrooxyoctanoic acid?
The canonical SMILES for ethane;8-nitrooxyoctanoic acid is CC.O=C(O)CCCCCCCO[N+](=O)[O-].
What is the InChIKey of ethane;8-nitrooxyoctanoic acid?
The InChIKey is QXSKTNKSJYUDPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO5.C2H6/c10-8(11)6-4-2-1-3-5-7-14-9(12)13;1-2/h1-7H2,(H,10,11);1-2H3.
What are the key properties of ethane;8-nitrooxyoctanoic acid?
ethane;8-nitrooxyoctanoic acid has a molecular weight of 235.28 g/mol, XLogP of 2.65, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;8-nitrooxyoctanoic acid is sourced from PubChem (CID 173056410), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).