About 6-methoxyhexyl nitrate
6-methoxyhexyl nitrate (PubChem CID 25193534) has the molecular formula C7H15NO4
and a molecular weight of 177.20 g/mol. Its IUPAC name is 6-methoxyhexyl nitrate.
Molecular Properties
| Compound Name | 6-methoxyhexyl nitrate |
| PubChem CID | 25193534 |
| Molecular Formula | C7H15NO4 |
| Molecular Weight | 177.20 g/mol |
| Exact Mass | 177.10 |
| IUPAC Name | 6-methoxyhexyl nitrate |
| SMILES | COCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C7H15NO4/c1-11-6-4-2-3-5-7-12-8(9)10/h2-7H2,1H3 |
| InChIKey | DWNBXDKNUSKNIQ-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 61.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.20 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6-methoxyhexyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-methoxyhexyl nitrate?
The IUPAC name of 6-methoxyhexyl nitrate (CID 25193534) is 6-methoxyhexyl nitrate.
What is the SMILES notation for 6-methoxyhexyl nitrate?
The canonical SMILES for 6-methoxyhexyl nitrate is COCCCCCCO[N+](=O)[O-].
What is the InChIKey of 6-methoxyhexyl nitrate?
The InChIKey is DWNBXDKNUSKNIQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO4/c1-11-6-4-2-3-5-7-12-8(9)10/h2-7H2,1H3.
What are the key properties of 6-methoxyhexyl nitrate?
6-methoxyhexyl nitrate has a molecular weight of 177.20 g/mol, XLogP of 1.40, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-methoxyhexyl nitrate is sourced from PubChem (CID 25193534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).