ethane;9-nitrooxynonanoic acid

C11H23NO5 — CID 173056484

IUPACethane;9-nitrooxynonanoic acid
SMILESCC.O=C(O)CCCCCCCCO[N+](=O)[O-]
InChIInChI=1S/C9H17NO5.C2H6/c11-9(12)7-5-3-1-2-4-6-8-15-10(13)14;1-2/h1-8H2,(H,11,12);1-2H3
InChIKeyURALFSLFGDUPQL-UHFFFAOYSA-N
MW249.31 g/mol
LogP3.04
Rot. Bonds10

About ethane;9-nitrooxynonanoic acid

ethane;9-nitrooxynonanoic acid (PubChem CID 173056484) has the molecular formula C11H23NO5 and a molecular weight of 249.31 g/mol. Its IUPAC name is ethane;9-nitrooxynonanoic acid.

Molecular Properties

Compound Nameethane;9-nitrooxynonanoic acid
PubChem CID173056484
Molecular FormulaC11H23NO5
Molecular Weight249.31 g/mol
Exact Mass249.16
IUPAC Nameethane;9-nitrooxynonanoic acid
SMILESCC.O=C(O)CCCCCCCCO[N+](=O)[O-]
InChIInChI=1S/C9H17NO5.C2H6/c11-9(12)7-5-3-1-2-4-6-8-15-10(13)14;1-2/h1-8H2,(H,11,12);1-2H3
InChIKeyURALFSLFGDUPQL-UHFFFAOYSA-N
XLogP3.04
TPSA89.67 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms17
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.31
LogP ≤ 53.04
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze ethane;9-nitrooxynonanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

ethane;8-nitrooxyoctanoic acid
CID 173056410
6-nitrooxyhexanoic acid;hydrochloride
CID 175070596
methane;11-nitrooxyundecanoic acid
CID 173491746
6-(6-nitrooxyhexanoyloxy)hexanoic acid
CID 155796489
6-methoxyhexyl nitrate
CID 25193534
phosphane;tetradecyl nitrate
CID 174825024
8-hydroxyoctyl nitrate
CID 146450783
nitric acid;octadecanoic acid
CID 87918075
(10,10-dimethyl-5-oxoundecyl) nitrate
CID 58859462
14-nitrotetradecanoic acid
CID 21425099
potassium;dichloromethane;4-hydroxybutanoate;4-nitrooxybutanoic acid
CID 157409840
1,3-dinitrooxypropan-2-yl nitrate;octanoic acid
CID 130366765

Frequently Asked Questions

What is the IUPAC name of ethane;9-nitrooxynonanoic acid?
The IUPAC name of ethane;9-nitrooxynonanoic acid (CID 173056484) is ethane;9-nitrooxynonanoic acid.
What is the SMILES notation for ethane;9-nitrooxynonanoic acid?
The canonical SMILES for ethane;9-nitrooxynonanoic acid is CC.O=C(O)CCCCCCCCO[N+](=O)[O-].
What is the InChIKey of ethane;9-nitrooxynonanoic acid?
The InChIKey is URALFSLFGDUPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO5.C2H6/c11-9(12)7-5-3-1-2-4-6-8-15-10(13)14;1-2/h1-8H2,(H,11,12);1-2H3.
What are the key properties of ethane;9-nitrooxynonanoic acid?
ethane;9-nitrooxynonanoic acid has a molecular weight of 249.31 g/mol, XLogP of 3.04, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-nitrooxynonanoic acid is sourced from PubChem (CID 173056484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).