About ethane;9-nitrooxynonanoic acid
ethane;9-nitrooxynonanoic acid (PubChem CID 173056484) has the molecular formula C11H23NO5
and a molecular weight of 249.31 g/mol. Its IUPAC name is ethane;9-nitrooxynonanoic acid.
Molecular Properties
| Compound Name | ethane;9-nitrooxynonanoic acid |
| PubChem CID | 173056484 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 249.31 g/mol |
| Exact Mass | 249.16 |
| IUPAC Name | ethane;9-nitrooxynonanoic acid |
| SMILES | CC.O=C(O)CCCCCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO5.C2H6/c11-9(12)7-5-3-1-2-4-6-8-15-10(13)14;1-2/h1-8H2,(H,11,12);1-2H3 |
| InChIKey | URALFSLFGDUPQL-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 89.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethane;9-nitrooxynonanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;9-nitrooxynonanoic acid?
The IUPAC name of ethane;9-nitrooxynonanoic acid (CID 173056484) is ethane;9-nitrooxynonanoic acid.
What is the SMILES notation for ethane;9-nitrooxynonanoic acid?
The canonical SMILES for ethane;9-nitrooxynonanoic acid is CC.O=C(O)CCCCCCCCO[N+](=O)[O-].
What is the InChIKey of ethane;9-nitrooxynonanoic acid?
The InChIKey is URALFSLFGDUPQL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17NO5.C2H6/c11-9(12)7-5-3-1-2-4-6-8-15-10(13)14;1-2/h1-8H2,(H,11,12);1-2H3.
What are the key properties of ethane;9-nitrooxynonanoic acid?
ethane;9-nitrooxynonanoic acid has a molecular weight of 249.31 g/mol, XLogP of 3.04, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;9-nitrooxynonanoic acid is sourced from PubChem (CID 173056484), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).