8-hydroxyoctyl nitrate

C8H17NO4 — CID 146450783

IUPAC8-hydroxyoctyl nitrate
SMILESO=[N+]([O-])OCCCCCCCCO
InChIInChI=1S/C8H17NO4/c10-7-5-3-1-2-4-6-8-13-9(11)12/h10H,1-8H2
InChIKeyBBFKWXHJKGYMLA-UHFFFAOYSA-N
MW191.23 g/mol
LogP1.53
Rot. Bonds9

About 8-hydroxyoctyl nitrate

8-hydroxyoctyl nitrate (PubChem CID 146450783) has the molecular formula C8H17NO4 and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-hydroxyoctyl nitrate.

Molecular Properties

Compound Name8-hydroxyoctyl nitrate
PubChem CID146450783
Molecular FormulaC8H17NO4
Molecular Weight191.23 g/mol
Exact Mass191.12
IUPAC Name8-hydroxyoctyl nitrate
SMILESO=[N+]([O-])OCCCCCCCCO
InChIInChI=1S/C8H17NO4/c10-7-5-3-1-2-4-6-8-13-9(11)12/h10H,1-8H2
InChIKeyBBFKWXHJKGYMLA-UHFFFAOYSA-N
XLogP1.53
TPSA72.60 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds9
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500191.23
LogP ≤ 51.53
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze 8-hydroxyoctyl nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 8-hydroxyoctyl nitrate?
The IUPAC name of 8-hydroxyoctyl nitrate (CID 146450783) is 8-hydroxyoctyl nitrate.
What is the SMILES notation for 8-hydroxyoctyl nitrate?
The canonical SMILES for 8-hydroxyoctyl nitrate is O=[N+]([O-])OCCCCCCCCO.
What is the InChIKey of 8-hydroxyoctyl nitrate?
The InChIKey is BBFKWXHJKGYMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4/c10-7-5-3-1-2-4-6-8-13-9(11)12/h10H,1-8H2.
What are the key properties of 8-hydroxyoctyl nitrate?
8-hydroxyoctyl nitrate has a molecular weight of 191.23 g/mol, XLogP of 1.53, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoctyl nitrate is sourced from PubChem (CID 146450783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).