About 8-hydroxyoctyl nitrate
8-hydroxyoctyl nitrate (PubChem CID 146450783) has the molecular formula C8H17NO4
and a molecular weight of 191.23 g/mol. Its IUPAC name is 8-hydroxyoctyl nitrate.
Molecular Properties
| Compound Name | 8-hydroxyoctyl nitrate |
| PubChem CID | 146450783 |
| Molecular Formula | C8H17NO4 |
| Molecular Weight | 191.23 g/mol |
| Exact Mass | 191.12 |
| IUPAC Name | 8-hydroxyoctyl nitrate |
| SMILES | O=[N+]([O-])OCCCCCCCCO |
| InChI | InChI=1S/C8H17NO4/c10-7-5-3-1-2-4-6-8-13-9(11)12/h10H,1-8H2 |
| InChIKey | BBFKWXHJKGYMLA-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 72.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.23 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-hydroxyoctyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-hydroxyoctyl nitrate?
The IUPAC name of 8-hydroxyoctyl nitrate (CID 146450783) is 8-hydroxyoctyl nitrate.
What is the SMILES notation for 8-hydroxyoctyl nitrate?
The canonical SMILES for 8-hydroxyoctyl nitrate is O=[N+]([O-])OCCCCCCCCO.
What is the InChIKey of 8-hydroxyoctyl nitrate?
The InChIKey is BBFKWXHJKGYMLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17NO4/c10-7-5-3-1-2-4-6-8-13-9(11)12/h10H,1-8H2.
What are the key properties of 8-hydroxyoctyl nitrate?
8-hydroxyoctyl nitrate has a molecular weight of 191.23 g/mol, XLogP of 1.53, 9 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-hydroxyoctyl nitrate is sourced from PubChem (CID 146450783), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).