About 6,6-dimethylheptyl nitrate
6,6-dimethylheptyl nitrate (PubChem CID 58979754) has the molecular formula C9H19NO3
and a molecular weight of 189.25 g/mol. Its IUPAC name is 6,6-dimethylheptyl nitrate.
Molecular Properties
| Compound Name | 6,6-dimethylheptyl nitrate |
| PubChem CID | 58979754 |
| Molecular Formula | C9H19NO3 |
| Molecular Weight | 189.25 g/mol |
| Exact Mass | 189.14 |
| IUPAC Name | 6,6-dimethylheptyl nitrate |
| SMILES | CC(C)(C)CCCCCO[N+](=O)[O-] |
| InChI | InChI=1S/C9H19NO3/c1-9(2,3)7-5-4-6-8-13-10(11)12/h4-8H2,1-3H3 |
| InChIKey | COCFCCFLHBRKRQ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 52.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.25 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dimethylheptyl nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dimethylheptyl nitrate?
The IUPAC name of 6,6-dimethylheptyl nitrate (CID 58979754) is 6,6-dimethylheptyl nitrate.
What is the SMILES notation for 6,6-dimethylheptyl nitrate?
The canonical SMILES for 6,6-dimethylheptyl nitrate is CC(C)(C)CCCCCO[N+](=O)[O-].
What is the InChIKey of 6,6-dimethylheptyl nitrate?
The InChIKey is COCFCCFLHBRKRQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19NO3/c1-9(2,3)7-5-4-6-8-13-10(11)12/h4-8H2,1-3H3.
What are the key properties of 6,6-dimethylheptyl nitrate?
6,6-dimethylheptyl nitrate has a molecular weight of 189.25 g/mol, XLogP of 2.80, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dimethylheptyl nitrate is sourced from PubChem (CID 58979754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).