C9H17NO4 — CID 58782341
(6,6-dimethyl-3-oxoheptyl) nitrate (PubChem CID 58782341) has the molecular formula C9H17NO4 and a molecular weight of 203.24 g/mol. Its IUPAC name is (6,6-dimethyl-3-oxoheptyl) nitrate.
| Compound Name | (6,6-dimethyl-3-oxoheptyl) nitrate |
|---|---|
| PubChem CID | 58782341 |
| Molecular Formula | C9H17NO4 |
| Molecular Weight | 203.24 g/mol |
| Exact Mass | 203.12 |
| IUPAC Name | (6,6-dimethyl-3-oxoheptyl) nitrate |
| SMILES | CC(C)(C)CCC(=O)CCO[N+](=O)[O-] |
| InChI | InChI=1S/C9H17NO4/c1-9(2,3)6-4-8(11)5-7-14-10(12)13/h4-7H2,1-3H3 |
| InChIKey | NNAZILMGTPCPNH-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 69.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.24 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|