C11H22N2O6 — CID 90323338
[2-ethyl-5,5-dimethyl-2-(nitrooxymethyl)hexyl] nitrate (PubChem CID 90323338) has the molecular formula C11H22N2O6 and a molecular weight of 278.30 g/mol. Its IUPAC name is [2-ethyl-5,5-dimethyl-2-(nitrooxymethyl)hexyl] nitrate.
| Compound Name | [2-ethyl-5,5-dimethyl-2-(nitrooxymethyl)hexyl] nitrate |
|---|---|
| PubChem CID | 90323338 |
| Molecular Formula | C11H22N2O6 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | [2-ethyl-5,5-dimethyl-2-(nitrooxymethyl)hexyl] nitrate |
| SMILES | CCC(CCC(C)(C)C)(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C11H22N2O6/c1-5-11(8-18-12(14)15,9-19-13(16)17)7-6-10(2,3)4/h5-9H2,1-4H3 |
| InChIKey | SUWVZVYSNGOFOL-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|