About acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate
acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate (PubChem CID 159893865) has the molecular formula C15H29N3O9S2
and a molecular weight of 459.54 g/mol. Its IUPAC name is acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate.
Molecular Properties
| Compound Name | acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate |
| PubChem CID | 159893865 |
| Molecular Formula | C15H29N3O9S2 |
| Molecular Weight | 459.54 g/mol |
| Exact Mass | 459.13 |
| IUPAC Name | acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate |
| SMILES | CC(=O)C#N.CCC(CC)(CO[N+](=O)[O-])CO[N+](=O)[O-].OCC(CO)(CS)CS |
| InChI | InChI=1S/C7H14N2O6.C5H12O2S2.C3H3NO/c1-3-7(4-2,5-14-8(10)11)6-15-9(12)13;6-1-5(2-7,3-8)4-9;1-3(5)2-4/h3-6H2,1-2H3;6-9H,1-4H2;1H3 |
| InChIKey | NVCBSDZFPJLDPR-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 186.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 459.54 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_cyanide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate?
The IUPAC name of acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate (CID 159893865) is acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate.
What is the SMILES notation for acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate?
The canonical SMILES for acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate is CC(=O)C#N.CCC(CC)(CO[N+](=O)[O-])CO[N+](=O)[O-].OCC(CO)(CS)CS.
What is the InChIKey of acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate?
The InChIKey is NVCBSDZFPJLDPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O6.C5H12O2S2.C3H3NO/c1-3-7(4-2,5-14-8(10)11)6-15-9(12)13;6-1-5(2-7,3-8)4-9;1-3(5)2-4/h3-6H2,1-2H3;6-9H,1-4H2;1H3.
What are the key properties of acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate?
acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate has a molecular weight of 459.54 g/mol, XLogP of 1.13, 12 rotatable bonds, 4 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for acetyl cyanide;2,2-bis(sulfanylmethyl)propane-1,3-diol;[2-ethyl-2-(nitrooxymethyl)butyl] nitrate is sourced from PubChem (CID 159893865), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).