C6H9N3O11 — CID 86197232
4-nitrooxy-3,3-bis(nitrooxymethyl)butanoic acid (PubChem CID 86197232) has the molecular formula C6H9N3O11 and a molecular weight of 299.15 g/mol. Its IUPAC name is 4-nitrooxy-3,3-bis(nitrooxymethyl)butanoic acid.
| Compound Name | 4-nitrooxy-3,3-bis(nitrooxymethyl)butanoic acid |
|---|---|
| PubChem CID | 86197232 |
| Molecular Formula | C6H9N3O11 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 299.02 |
| IUPAC Name | 4-nitrooxy-3,3-bis(nitrooxymethyl)butanoic acid |
| SMILES | O=C(O)CC(CO[N+](=O)[O-])(CO[N+](=O)[O-])CO[N+](=O)[O-] |
| InChI | InChI=1S/C6H9N3O11/c10-5(11)1-6(2-18-7(12)13,3-19-8(14)15)4-20-9(16)17/h1-4H2,(H,10,11) |
| InChIKey | AGLWDLRTWFJLKX-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 194.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|