C6H8AgNO10 — CID 161239794
silver;2-hydroxypropane-1,2,3-tricarboxylic acid;nitrate (PubChem CID 161239794) has the molecular formula C6H8AgNO10 and a molecular weight of 362.00 g/mol. Its IUPAC name is silver;2-hydroxypropane-1,2,3-tricarboxylic acid;nitrate.
| Compound Name | silver;2-hydroxypropane-1,2,3-tricarboxylic acid;nitrate |
|---|---|
| PubChem CID | 161239794 |
| Molecular Formula | C6H8AgNO10 |
| Molecular Weight | 362.00 g/mol |
| Exact Mass | 360.92 |
| IUPAC Name | silver;2-hydroxypropane-1,2,3-tricarboxylic acid;nitrate |
| SMILES | O=C(O)CC(O)(CC(=O)O)C(=O)O.O=[N+]([O-])[O-].[Ag+] |
| InChI | InChI=1S/C6H8O7.Ag.NO3/c7-3(8)1-6(13,5(11)12)2-4(9)10;;2-1(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);;/q;+1;-1 |
| InChIKey | UZVQOEUTOCRSJN-UHFFFAOYSA-N |
| XLogP | -1.49 |
| TPSA | 198.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.00 |
| LogP ≤ 5 | -1.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|