C7H11NO9 — CID 87358065
2-hydroxypropane-1,2,3-tricarboxylic acid;nitromethane (PubChem CID 87358065) has the molecular formula C7H11NO9 and a molecular weight of 253.16 g/mol. Its IUPAC name is 2-hydroxypropane-1,2,3-tricarboxylic acid;nitromethane.
| Compound Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;nitromethane |
|---|---|
| PubChem CID | 87358065 |
| Molecular Formula | C7H11NO9 |
| Molecular Weight | 253.16 g/mol |
| Exact Mass | 253.04 |
| IUPAC Name | 2-hydroxypropane-1,2,3-tricarboxylic acid;nitromethane |
| SMILES | C[N+](=O)[O-].O=C(O)CC(O)(CC(=O)O)C(=O)O |
| InChI | InChI=1S/C6H8O7.CH3NO2/c7-3(8)1-6(13,5(11)12)2-4(9)10;1-2(3)4/h13H,1-2H2,(H,7,8)(H,9,10)(H,11,12);1H3 |
| InChIKey | MGVVFANWOPFGIN-UHFFFAOYSA-N |
| XLogP | -1.36 |
| TPSA | 175.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.16 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|