C10H20N2O5 — CID 88612562
4-methyl-4-[(2-methyl-1-nitrooxypropan-2-yl)amino]pentanoic acid (PubChem CID 88612562) has the molecular formula C10H20N2O5 and a molecular weight of 248.28 g/mol. Its IUPAC name is 4-methyl-4-[(2-methyl-1-nitrooxypropan-2-yl)amino]pentanoic acid.
| Compound Name | 4-methyl-4-[(2-methyl-1-nitrooxypropan-2-yl)amino]pentanoic acid |
|---|---|
| PubChem CID | 88612562 |
| Molecular Formula | C10H20N2O5 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | 4-methyl-4-[(2-methyl-1-nitrooxypropan-2-yl)amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(C)(C)CO[N+](=O)[O-] |
| InChI | InChI=1S/C10H20N2O5/c1-9(2,6-5-8(13)14)11-10(3,4)7-17-12(15)16/h11H,5-7H2,1-4H3,(H,13,14) |
| InChIKey | UIFMJUSBUMSVSA-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 101.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|