C8H12F3NO3 — CID 62043301
4-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid (PubChem CID 62043301) has the molecular formula C8H12F3NO3 and a molecular weight of 227.18 g/mol. Its IUPAC name is 4-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid.
| Compound Name | 4-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
|---|---|
| PubChem CID | 62043301 |
| Molecular Formula | C8H12F3NO3 |
| Molecular Weight | 227.18 g/mol |
| Exact Mass | 227.08 |
| IUPAC Name | 4-methyl-4-[(2,2,2-trifluoroacetyl)amino]pentanoic acid |
| SMILES | CC(C)(CCC(=O)O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C8H12F3NO3/c1-7(2,4-3-5(13)14)12-6(15)8(9,10)11/h3-4H2,1-2H3,(H,12,15)(H,13,14) |
| InChIKey | JTEWGUPKGKHKSM-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.18 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |