2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride

C6H8ClF3NO3- — CID 86602100

IUPAC2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride
SMILESCC(C)(NC(=O)C(F)(F)F)C(=O)O.[Cl-]
InChIInChI=1S/C6H8F3NO3.ClH/c1-5(2,4(12)13)10-3(11)6(7,8)9;/h1-2H3,(H,10,11)(H,12,13);1H/p-1
InChIKeyHBEIAJHQOAYLLT-UHFFFAOYSA-M
MW234.58 g/mol
LogP-2.47
Rot. Bonds2

About 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride

2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride (PubChem CID 86602100) has the molecular formula C6H8ClF3NO3- and a molecular weight of 234.58 g/mol. Its IUPAC name is 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride.

Molecular Properties

Compound Name2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride
PubChem CID86602100
Molecular FormulaC6H8ClF3NO3-
Molecular Weight234.58 g/mol
Exact Mass234.02
IUPAC Name2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride
SMILESCC(C)(NC(=O)C(F)(F)F)C(=O)O.[Cl-]
InChIInChI=1S/C6H8F3NO3.ClH/c1-5(2,4(12)13)10-3(11)6(7,8)9;/h1-2H3,(H,10,11)(H,12,13);1H/p-1
InChIKeyHBEIAJHQOAYLLT-UHFFFAOYSA-M
XLogP-2.47
TPSA66.40 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500234.58
LogP ≤ 5-2.47
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride?
The IUPAC name of 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride (CID 86602100) is 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride.
What is the SMILES notation for 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride?
The canonical SMILES for 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride is CC(C)(NC(=O)C(F)(F)F)C(=O)O.[Cl-].
What is the InChIKey of 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride?
The InChIKey is HBEIAJHQOAYLLT-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H8F3NO3.ClH/c1-5(2,4(12)13)10-3(11)6(7,8)9;/h1-2H3,(H,10,11)(H,12,13);1H/p-1.
What are the key properties of 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride?
2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride has a molecular weight of 234.58 g/mol, XLogP of -2.47, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoic acid chloride is sourced from PubChem (CID 86602100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).