C11H16F3NO3 — CID 134919044
(E,2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoic acid (PubChem CID 134919044) has the molecular formula C11H16F3NO3 and a molecular weight of 267.25 g/mol. Its IUPAC name is (E,2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoic acid.
| Compound Name | (E,2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoic acid |
|---|---|
| PubChem CID | 134919044 |
| Molecular Formula | C11H16F3NO3 |
| Molecular Weight | 267.25 g/mol |
| Exact Mass | 267.11 |
| IUPAC Name | (E,2S,3S)-2,3-dimethyl-2-[(2,2,2-trifluoroacetyl)amino]hept-4-enoic acid |
| SMILES | CC/C=C/[C@H](C)[C@](C)(NC(=O)C(F)(F)F)C(=O)O |
| InChI | InChI=1S/C11H16F3NO3/c1-4-5-6-7(2)10(3,9(17)18)15-8(16)11(12,13)14/h5-7H,4H2,1-3H3,(H,15,16)(H,17,18)/b6-5+/t7-,10-/m0/s1 |
| InChIKey | ZVNSOFKBXLBZIE-JPWADCQBSA-N |
| XLogP | 2.11 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.25 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|