C6H10F3NO4S — CID 90380771
N-(1-ethoxyethylsulfonyl)-2,2,2-trifluoroacetamide (PubChem CID 90380771) has the molecular formula C6H10F3NO4S and a molecular weight of 249.21 g/mol. Its IUPAC name is N-(1-ethoxyethylsulfonyl)-2,2,2-trifluoroacetamide.
| Compound Name | N-(1-ethoxyethylsulfonyl)-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 90380771 |
| Molecular Formula | C6H10F3NO4S |
| Molecular Weight | 249.21 g/mol |
| Exact Mass | 249.03 |
| IUPAC Name | N-(1-ethoxyethylsulfonyl)-2,2,2-trifluoroacetamide |
| SMILES | CCOC(C)S(=O)(=O)NC(=O)C(F)(F)F |
| InChI | InChI=1S/C6H10F3NO4S/c1-3-14-4(2)15(12,13)10-5(11)6(7,8)9/h4H,3H2,1-2H3,(H,10,11) |
| InChIKey | POSATZBUSPOEQG-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.21 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |