C2H3F3NNaO4S — CID 173392621
sodium;hydride;(2,2,2-trifluoroacetyl)sulfamic acid (PubChem CID 173392621) has the molecular formula C2H3F3NNaO4S and a molecular weight of 217.10 g/mol. Its IUPAC name is sodium;hydride;(2,2,2-trifluoroacetyl)sulfamic acid.
| Compound Name | sodium;hydride;(2,2,2-trifluoroacetyl)sulfamic acid |
|---|---|
| PubChem CID | 173392621 |
| Molecular Formula | C2H3F3NNaO4S |
| Molecular Weight | 217.10 g/mol |
| Exact Mass | 216.96 |
| IUPAC Name | sodium;hydride;(2,2,2-trifluoroacetyl)sulfamic acid |
| SMILES | O=C(NS(=O)(=O)O)C(F)(F)F.[H-].[Na+] |
| InChI | InChI=1S/C2H2F3NO4S.Na.H/c3-2(4,5)1(7)6-11(8,9)10;;/h(H,6,7)(H,8,9,10);;/q;+1;-1 |
| InChIKey | LDYLGQFXESSJFR-UHFFFAOYSA-N |
| XLogP | -3.42 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.10 |
| LogP ≤ 5 | -3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|